CAS 774556-83-1
:1-(4-fluorophenyl)-N-(pyridin-2-ylmethyl)methanamine
Description:
1-(4-fluorophenyl)-N-(pyridin-2-ylmethyl)methanamine, with the CAS number 774556-83-1, is a chemical compound characterized by its unique structure, which includes a fluorophenyl group and a pyridinylmethyl moiety. This compound typically exhibits properties associated with amines, such as basicity due to the presence of the amine functional group. The fluorine atom in the para position of the phenyl ring can influence the compound's electronic properties, potentially enhancing its reactivity and solubility in organic solvents. The pyridine ring contributes to the compound's aromatic character and may also participate in hydrogen bonding interactions. In terms of applications, compounds of this nature are often explored in medicinal chemistry for their potential biological activity, particularly in the development of pharmaceuticals targeting various receptors or enzymes. The presence of both aromatic and aliphatic components in its structure suggests that it may exhibit diverse interactions in biological systems, making it a subject of interest for further research and development.
Formula:C13H13FN2
InChI:InChI=1/C13H13FN2/c14-12-6-4-11(5-7-12)9-15-10-13-3-1-2-8-16-13/h1-8,15H,9-10H2
SMILES:c1ccnc(c1)CNCc1ccc(cc1)F
Synonyms:- 2-pyridinemethanamine, N-[(4-fluorophenyl)methyl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.