CAS 774561-61-4

2-(4,6-Diethyl-4,8-dimethyl-2-oxo-4H-pyrrolo[3,2,1-ij]quinolin-1(2H)-ylidene)propanedinitrile

Description:

2-(4,6-Diethyl-4,8-dimethyl-2-oxo-4H-pyrrolo[3,2,1-ij]quinolin-1(2H)-ylidene)propanedinitrile, with the CAS number 774561-61-4, is a complex organic compound characterized by its unique pyrroloquinoline structure. This substance features multiple functional groups, including a ylidene moiety and a dinitrile group, which contribute to its chemical reactivity and potential applications. The presence of ethyl and methyl substituents on the pyrroloquinoline core enhances its lipophilicity and may influence its biological activity. The compound is likely to exhibit interesting optical properties due to its conjugated system, making it a candidate for studies in materials science or medicinal chemistry. Additionally, its structural complexity suggests potential for diverse interactions in biological systems, warranting further investigation into its pharmacological properties. As with many organic compounds, safety and handling precautions should be observed, given the potential toxicity associated with nitrile groups. Overall, this compound represents a fascinating area of study within organic and medicinal chemistry.

Formula: C₂₀H₁₉N₃O

InChI: InChI=1S/C20H19N3O/c1-5-13-9-20(4,6-2)23-18-15(13)7-12(3)8-16(18)17(19(23)24)14(10-21)11-22/h7-9H,5-6H2,1-4H3

InChI key: InChIKey=AEROOYRXTPKXPF-UHFFFAOYSA-N

SMILES: C(C#N)(C#N)=C1C=2C=3N(C(CC)(C)C=C(CC)C3C=C(C)C2)C1=O

Synonyms:

• 2-(4,6-Diethyl-4,8-dimethyl-2-oxo-4H-pyrrolo[3,2,1-ij]quinolin-1(2H)-ylidene)propanedinitrile
• Propanedinitrile, 2-(4,6-diethyl-4,8-dimethyl-2-oxo-4H-pyrrolo[3,2,1-ij]quinolin-1(2H)-ylidene)-