CAS 774565-99-0
:Ethyl 2-[(4-amino-1,3,5-triazin-2-yl)thio]acetate
Description:
Ethyl 2-[(4-amino-1,3,5-triazin-2-yl)thio]acetate is a chemical compound characterized by its unique structure, which includes an ethyl ester group and a thioether linkage to a triazine ring. The presence of the amino group on the triazine contributes to its potential reactivity and biological activity. This compound is typically a solid or liquid at room temperature, depending on its purity and specific formulation. It is soluble in polar organic solvents, which enhances its utility in various chemical applications. The triazine moiety is known for its role in agrochemicals and pharmaceuticals, often exhibiting herbicidal or antimicrobial properties. Additionally, the thioether functionality can influence the compound's stability and reactivity, making it a subject of interest in synthetic chemistry and drug development. Safety data should be consulted for handling and usage, as compounds with similar structures may exhibit toxicity or environmental hazards. Overall, Ethyl 2-[(4-amino-1,3,5-triazin-2-yl)thio]acetate represents a versatile chemical with potential applications in various fields.
Formula:C7H10N4O2S
InChI:InChI=1S/C7H10N4O2S/c1-2-13-5(12)3-14-7-10-4-9-6(8)11-7/h4H,2-3H2,1H3,(H2,8,9,10,11)
InChI key:InChIKey=CFQJXFZTZOIWNN-UHFFFAOYSA-N
SMILES:S(CC(OCC)=O)C=1N=C(N)N=CN1
Synonyms:- Acetic acid, 2-[(4-amino-1,3,5-triazin-2-yl)thio]-, ethyl ester
- Ethyl 2-[(4-amino-1,3,5-triazin-2-yl)thio]acetate
- Acetic acid, [(4-amino-1,3,5-triazin-2-yl)thio]-, ethyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.