CymitQuimica logo

CAS 774575-30-3

:

2-(3-Chloro-4-fluorophenoxy)acetic acid hydrazide

Description:
2-(3-Chloro-4-fluorophenoxy)acetic acid hydrazide, identified by its CAS number 774575-30-3, is a chemical compound that features a hydrazide functional group linked to a phenoxyacetic acid moiety. This compound typically exhibits characteristics such as being a solid at room temperature, with potential applications in pharmaceuticals or agrochemicals due to its unique structural features. The presence of chlorine and fluorine substituents on the aromatic ring can influence its reactivity and biological activity, potentially enhancing its efficacy in various applications. The hydrazide functional group may also impart specific properties, such as the ability to form hydrogen bonds, which can be crucial for interactions with biological targets. Additionally, the compound's solubility, stability, and reactivity can vary based on environmental conditions and the presence of other functional groups. Overall, 2-(3-Chloro-4-fluorophenoxy)acetic acid hydrazide is of interest in research and development, particularly in fields related to medicinal chemistry and agricultural science.
Formula:C8H8ClFN2O2
InChI:InChI=1S/C8H8ClFN2O2/c9-6-3-5(1-2-7(6)10)14-4-8(13)12-11/h1-3H,4,11H2,(H,12,13)
InChI key:InChIKey=WNOZXWXSEMYETA-UHFFFAOYSA-N
SMILES:O(CC(NN)=O)C1=CC(Cl)=C(F)C=C1
Synonyms:
  • Acetic acid, 2-(3-chloro-4-fluorophenoxy)-, hydrazide
  • 2-(3-Chloro-4-fluorophenoxy)acetic acid hydrazide
  • Acetic acid, (3-chloro-4-fluorophenoxy)-, hydrazide
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.