
CAS 77458-28-7
:1-(2-Chlorophenyl)-1H-pyrazol-4-ol
Description:
1-(2-Chlorophenyl)-1H-pyrazol-4-ol, with the CAS number 77458-28-7, is a chemical compound characterized by its pyrazole core, which is a five-membered ring containing two nitrogen atoms. This compound features a chlorophenyl group at the 1-position and a hydroxyl group at the 4-position of the pyrazole ring, contributing to its potential biological activity. It is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. The presence of the chlorine atom can influence its reactivity and interaction with biological systems, making it of interest in medicinal chemistry and agrochemical applications. The hydroxyl group can participate in hydrogen bonding, affecting its physical properties and interactions. Overall, this compound's unique structure may confer specific pharmacological properties, warranting further investigation in various chemical and biological contexts.
Formula:C9H7ClN2O
InChI:InChI=1S/C9H7ClN2O/c10-8-3-1-2-4-9(8)12-6-7(13)5-11-12/h1-6,13H
InChI key:InChIKey=LMJROHRJJIZESY-UHFFFAOYSA-N
SMILES:ClC1=C(C=CC=C1)N2C=C(O)C=N2
Synonyms:- 1H-Pyrazol-4-ol, 1-(2-chlorophenyl)-
- 1-(2-Chlorophenyl)-1H-pyrazol-4-ol
- 1-(2-Chlorophenyl)pyrazol-4-ol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.