CAS 77458-39-0
:1-(2,4-Dichlorophenyl)-1H-pyrazol-4-ol
Description:
1-(2,4-Dichlorophenyl)-1H-pyrazol-4-ol, with the CAS number 77458-39-0, is an organic compound characterized by its pyrazole ring structure substituted with a dichlorophenyl group. This compound typically exhibits a white to off-white crystalline appearance and is known for its potential applications in various fields, including pharmaceuticals and agrochemicals. The presence of the dichlorophenyl moiety contributes to its biological activity, which may include fungicidal or herbicidal properties. The compound's solubility can vary depending on the solvent, and it may demonstrate moderate stability under standard conditions. Its molecular structure allows for interactions with biological targets, making it of interest in medicinal chemistry. Safety data should be consulted for handling and exposure guidelines, as with many chemical substances, to ensure proper safety measures are taken during its use in research or industrial applications.
Formula:C9H6Cl2N2O
InChI:InChI=1S/C9H6Cl2N2O/c10-6-1-2-9(8(11)3-6)13-5-7(14)4-12-13/h1-5,14H
InChI key:InChIKey=KNOFJPJDYVWHSP-UHFFFAOYSA-N
SMILES:ClC1=C(C=CC(Cl)=C1)N2C=C(O)C=N2
Synonyms:- 1-(2,4-Dichlorophenyl)-1H-pyrazol-4-ol
- 1H-Pyrazol-4-ol, 1-(2,4-dichlorophenyl)-
- 1-(2,4-Dichlorophenyl)pyrazol-4-ol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.