CAS 774586-90-2
:4-[(6-Fluoro-3,4-dihydro-2-methyl-1(2H)-quinolinyl)sulfonyl]benzenamine
Description:
4-[(6-Fluoro-3,4-dihydro-2-methyl-1(2H)-quinolinyl)sulfonyl]benzenamine, with the CAS number 774586-90-2, is a chemical compound characterized by its complex structure that includes a quinoline moiety and a sulfonamide functional group. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, which may influence its solubility, stability, and reactivity. The presence of the fluorine atom suggests potential for enhanced biological activity or altered pharmacokinetics, while the sulfonyl group can enhance the compound's ability to interact with biological targets. Such compounds are often investigated for their potential therapeutic applications, particularly in medicinal chemistry, due to their ability to modulate biological pathways. The specific characteristics, such as melting point, boiling point, and spectral data, would require empirical measurement or literature reference for precise values. Overall, this compound represents a class of molecules that may have significant implications in drug development and pharmacology.
Formula:C16H17FN2O2S
InChI:InChI=1S/C16H17FN2O2S/c1-11-2-3-12-10-13(17)4-9-16(12)19(11)22(20,21)15-7-5-14(18)6-8-15/h4-11H,2-3,18H2,1H3
InChI key:InChIKey=RTZPTSSDADQAHF-UHFFFAOYSA-N
SMILES:S(=O)(=O)(N1C=2C(CCC1C)=CC(F)=CC2)C3=CC=C(N)C=C3
Synonyms:- Benzenamine, 4-[(6-fluoro-3,4-dihydro-2-methyl-1(2H)-quinolinyl)sulfonyl]-
- 4-[(6-Fluoro-3,4-dihydro-2-methyl-1(2H)-quinolinyl)sulfonyl]benzenamine
- Quinoline, 1-[(4-aminophenyl)sulfonyl]-6-fluoro-1,2,3,4-tetrahydro-2-methyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.