CAS 77459-78-0
:5′-HydroxyPiroxicam
Description:
5′-HydroxyPiroxicam, with the CAS number 77459-78-0, is a derivative of piroxicam, a non-steroidal anti-inflammatory drug (NSAID) commonly used for its analgesic and anti-inflammatory properties. This compound is characterized by the presence of a hydroxyl group at the 5′ position of the piroxicam structure, which may influence its pharmacological activity and metabolic profile. Like other piroxicam derivatives, 5′-HydroxyPiroxicam is expected to exhibit anti-inflammatory effects by inhibiting cyclooxygenase enzymes (COX-1 and COX-2), thereby reducing the synthesis of prostaglandins involved in inflammation and pain signaling. The compound may also possess distinct solubility and stability characteristics compared to its parent compound, which can affect its bioavailability and therapeutic efficacy. Additionally, the presence of the hydroxyl group may enhance its interaction with biological targets or influence its pharmacokinetics. As with any pharmaceutical compound, understanding its safety profile, potential side effects, and interactions with other medications is crucial for its clinical application.
Formula:C15H13N3O5S
InChI:InChI=1S/C15H13N3O5S/c1-18-13(15(21)17-12-7-6-9(19)8-16-12)14(20)10-4-2-3-5-11(10)24(18,22)23/h2-8,19-20H,1H3,(H,16,17,21)
InChI key:InChIKey=CCKOORANQAQKKV-UHFFFAOYSA-N
SMILES:OC=1C=2C(S(=O)(=O)N(C)C1C(NC3=CC=C(O)C=N3)=O)=CC=CC2
Synonyms:- 2H-1,2-Benzothiazine-3-carboxamide, 4-hydroxy-N-(5-hydroxy-2-pyridinyl)-2-methyl-, 1,1-dioxide
- 5′-HydroxyPiroxicam
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Piroxicam-5'-hydroxy
CAS:Controlled ProductFormula:C15H13N3O5SColor and Shape:NeatMolecular weight:347.34
