CAS 7746-28-3
:3,6-Dimethyl-1H-indazole
Description:
3,6-Dimethyl-1H-indazole is an organic compound characterized by its indazole structure, which consists of a five-membered ring fused to a six-membered aromatic ring. This compound features two methyl groups attached to the 3 and 6 positions of the indazole ring, contributing to its unique chemical properties. It is typically a crystalline solid at room temperature and is soluble in organic solvents such as ethanol and dimethyl sulfoxide (DMSO). The presence of the methyl groups can influence its reactivity and stability, making it of interest in various chemical and pharmaceutical applications. 3,6-Dimethyl-1H-indazole may exhibit biological activity, which has led to research into its potential use in medicinal chemistry. Its molecular structure allows for various functionalization possibilities, making it a versatile building block in synthetic organic chemistry. As with many indazole derivatives, it is important to handle this compound with care, following appropriate safety protocols due to potential toxicity or reactivity.
Formula:C9H10N2
InChI:InChI=1S/C9H10N2/c1-6-3-4-8-7(2)10-11-9(8)5-6/h3-5H,1-2H3,(H,10,11)
InChI key:InChIKey=YELUYTLFUPWAIQ-UHFFFAOYSA-N
SMILES:CC=1C=2C(NN1)=CC(C)=CC2
Synonyms:- 1H-Indazole, 3,6-dimethyl-
- 3,6-Dimethyl-1H-indazole
- 3,6-Dimethyl-2H-indazole
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
