
CAS 7746-31-8
:5,6-Dimethoxy-3-methyl-1H-indazole
Description:
5,6-Dimethoxy-3-methyl-1H-indazole is an organic compound characterized by its indazole core, which consists of a five-membered ring fused to a six-membered aromatic ring. The presence of two methoxy groups at the 5 and 6 positions, along with a methyl group at the 3 position, contributes to its unique chemical properties and reactivity. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents due to the presence of the methoxy groups, which can enhance its polarity. The indazole structure is known for its potential biological activity, making compounds like 5,6-Dimethoxy-3-methyl-1H-indazole of interest in medicinal chemistry and pharmacology. Its CAS number, 7746-31-8, allows for easy identification in chemical databases. As with many organic compounds, it is essential to handle it with care, considering safety protocols and potential hazards associated with its use.
Formula:C10H12N2O2
InChI:InChI=1S/C10H12N2O2/c1-6-7-4-9(13-2)10(14-3)5-8(7)12-11-6/h4-5H,1-3H3,(H,11,12)
InChI key:InChIKey=ZOQBOJGXVDTPEJ-UHFFFAOYSA-N
SMILES:CC=1C=2C(=CC(OC)=C(OC)C2)NN1
Synonyms:- 5,6-Dimethoxy-3-methyl-1H-indazole
- 1H-Indazole, 5,6-dimethoxy-3-methyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.