CAS 774603-04-2

(9E,12Z)-10-Nitro-9,12-octadecadienoic acid

Description:

(9E,12Z)-10-Nitro-9,12-octadecadienoic acid is a chemical compound characterized by its long carbon chain and the presence of both a nitro group and multiple double bonds. This substance features a conjugated diene system, which contributes to its reactivity and potential biological activity. The specific configuration of the double bonds, indicated by the E and Z nomenclature, suggests that it has distinct geometric isomers, influencing its physical and chemical properties. The nitro group introduces a polar functional group, which can enhance solubility in polar solvents and may affect the compound's interaction with biological systems. This compound is of interest in various fields, including organic synthesis and medicinal chemistry, due to its potential applications in drug development and as a biochemical probe. Its stability, reactivity, and interactions with other molecules can be influenced by environmental factors such as pH and temperature, making it a subject of study in both synthetic and applied chemistry contexts.

Formula: C₁₈H₃₁NO₄

InChI: InChI=1S/C18H31NO4/c1-2-3-4-5-8-11-14-17(19(22)23)15-12-9-6-7-10-13-16-18(20)21/h8,11,15H,2-7,9-10,12-14,16H2,1H3,(H,20,21)/b11-8-,17-15+

InChI key: InChIKey=LELVHAQTWXTCLY-XYWKCAQWSA-N

SMILES: C(=C\CCCCCCCC(O)=O)(\C/C=C\CCCCC)/N(=O)=O

Synonyms:

• (9E,12Z)-10-Nitro-9,12-octadecadienoic acid
• 9,12-Octadecadienoic acid, 10-nitro-, (9E,12Z)-

10-Nitro-9(E)-12(Z)-Octadecadienoic acid

CAS: 774603-04-2

Formula: C18H31NO4

Purity: >98%

Color and Shape: In solution, Ethanol

Molecular weight: 325.44

Ref: 48-12-1873

10-Nitrolinoleic acid

CAS: 774603-04-2

10-Nitrolinoleate, a nitration product of linoleate, modulates PPARγ, enhancing glucose uptake, and aids in muscle relaxation via NO/cGMP pathway.

Formula: C₁₈H₃₁NO₄

Color and Shape: Solid

Molecular weight: 325.44

Ref: TM-T37787