CAS 774608-50-3: Boronic acid, (5-bromo-2-chlorophenyl)-

Description:Boronic acid, specifically (5-bromo-2-chlorophenyl)-, is an organoboron compound characterized by the presence of a boronic acid functional group (-B(OH)2) attached to a phenyl ring that is substituted with both bromine and chlorine atoms. This compound typically exhibits properties such as being a white to off-white solid, with moderate solubility in polar solvents like water and alcohols, due to the presence of the boronic acid group. It is known for its reactivity in various organic synthesis reactions, particularly in Suzuki coupling reactions, where it can react with aryl halides to form biaryl compounds. The presence of halogen substituents can influence its reactivity and the electronic properties of the phenyl ring, making it a valuable intermediate in the synthesis of pharmaceuticals and agrochemicals. Additionally, boronic acids are recognized for their ability to form reversible complexes with diols, which can be exploited in sensor technology and drug delivery systems.

Formula:C₆H₅BBrClO₂

InChI:InChI=1S/C6H5BBrClO2/c8-4-1-2-6(9)5(3-4)7(10)11/h1-3,10-11H

InChI key:InChIKey=IWUGPRLLWXXECY-UHFFFAOYSA-N

SMILES:ClC1=CC=C(Br)C=C1B(O)O

Synonyms:
Boronic acid, (5-bromo-2-chlorophenyl)-
Boronic acid, B-(5-bromo-2-chlorophenyl)-
B-(5-Bromo-2-chlorophenyl)boronic acid
(5-Bromo-2-chlorophenyl)boronic acid

Found 4 products.

Product data	Purity	Price range	Estimated delivery
(5-Bromo-2-chlorophenyl)boronic acid REF: 10-F437327CAS: 774608-50-3	95.0%	21.00 €~100.00 €	Tue 29 Apr 25
5-Bromo-2-chlorophenylboronic acid REF: IN-DA00GA0ECAS: 774608-50-3	95%	To inquire	Tue 06 May 25
(5-Bromo-2-chlorophenyl)boronic acid REF: 54-OR904117CAS: 774608-50-3	95%	62.00 €~830.00 €	Mon 05 May 25
5-Bromo-2-chlorophenylboronic acid REF: 3D-ZFB60850CAS: 774608-50-3	Min. 95%	- - -	Discontinued product