CAS 774608-89-8

Ethyl 5-bromo-1H-1,2,4-triazole-3-carboxylate

Description:

Ethyl 5-bromo-1H-1,2,4-triazole-3-carboxylate is a chemical compound characterized by its triazole ring, which is a five-membered heterocyclic structure containing three nitrogen atoms. This compound features a bromine substituent at the 5-position of the triazole ring and an ethyl ester functional group at the carboxylic acid position (3-position). The presence of the bromine atom enhances its reactivity and potential applications in various chemical reactions, including nucleophilic substitutions. Ethyl 5-bromo-1H-1,2,4-triazole-3-carboxylate is often utilized in medicinal chemistry and agricultural chemistry, particularly in the synthesis of biologically active compounds. Its solubility in organic solvents and moderate stability under standard conditions make it a valuable intermediate in organic synthesis. Additionally, the compound's structure allows for potential interactions with biological targets, making it of interest for further research in drug development and agrochemical applications. Safety and handling precautions should be observed due to the presence of bromine and the potential for toxicity associated with triazole derivatives.

Formula: C₅H₆BrN₃O₂

InChI: InChI=1/C5H6BrN3O2/c1-2-11-4(10)3-7-5(6)9-8-3/h2H2,1H3,(H,7,8,9)

SMILES: CCOC(=O)c1nc(Br)[nH]n1

Synonyms:

• 1H-1,2,4-triazole-3-carboxylic acid, 5-bromo-, ethyl ester

Ethyl 5-bromo-1H-1,2,4-triazole-3-carboxylate

CAS: 774608-89-8

Formula: C₅H₆BrN₃O₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 220.0240

Ref: IN-DA003QCB

Ethyl 5-bromo-1H-1,2,4-triazole-3-carboxylate

CAS: 774608-89-8

Ethyl 5-bromo-1H-1,2,4-triazole-3-carboxylate

Purity: 98%

Molecular weight: 220.03g/mol

Ref: 54-OR73357

Ethyl 5-bromo-1H-1,2,4-triazole-3-carboxylate

CAS: 774608-89-8

Formula: C₅H₆BrN₃O₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 220.026

Ref: 10-F076352