CymitQuimica logo

CAS 77464-11-0

:

4-phenylpiperazine-1-carboxamide

Description:
4-Phenylpiperazine-1-carboxamide is a chemical compound characterized by its piperazine core, which is a six-membered ring containing two nitrogen atoms. This compound features a phenyl group attached to the piperazine ring, contributing to its aromatic properties. The carboxamide functional group (-CONH2) at the 1-position of the piperazine ring enhances its solubility in polar solvents and can influence its biological activity. Typically, compounds like 4-phenylpiperazine-1-carboxamide are studied for their potential pharmacological effects, particularly in the context of neurochemistry, as piperazine derivatives often exhibit interactions with neurotransmitter systems. The compound may also serve as a building block in the synthesis of more complex molecules in medicinal chemistry. Its molecular structure allows for various modifications, which can lead to diverse biological activities. Safety and handling precautions should be observed, as with any chemical substance, due to potential toxicity or reactivity.
Formula:C11H15N3O
InChI:InChI=1/C11H15N3O/c12-11(15)14-8-6-13(7-9-14)10-4-2-1-3-5-10/h1-5H,6-9H2,(H2,12,15)
Synonyms:
  • 1-Piperazinecarboxamide, 4-Phenyl-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.