CymitQuimica logo

CAS 77472-46-9

:

2(3H)-Benzoxazolone, 7-amino-, hydrochloride (1:1)

Description:
2(3H)-Benzoxazolone, 7-amino-, hydrochloride (1:1), with the CAS number 77472-46-9, is a chemical compound characterized by its benzoxazolone structure, which features a fused benzene and oxazolone ring. This compound typically appears as a white to off-white crystalline solid and is soluble in water, reflecting its hydrochloride form. The presence of the amino group at the 7-position of the benzoxazolone ring contributes to its basicity and potential reactivity, making it useful in various chemical applications, including as a reagent in organic synthesis and in the development of pharmaceuticals. The hydrochloride salt form enhances its stability and solubility in aqueous solutions, which is advantageous for biological studies. Additionally, compounds of this nature may exhibit biological activity, including antimicrobial or anti-inflammatory properties, although specific biological effects would depend on the context of use and concentration. As with all chemical substances, proper handling and safety precautions are essential due to potential toxicity or reactivity.
Formula:C7H6N2O2·ClH
InChI:InChI=1S/C7H6N2O2.ClH/c8-4-2-1-3-5-6(4)11-7(10)9-5;/h1-3H,8H2,(H,9,10);1H
InChI key:InChIKey=WIQJYLMXPNZASE-UHFFFAOYSA-N
SMILES:NC1=C2C(NC(=O)O2)=CC=C1.Cl
Synonyms:
  • 2(3H)-Benzoxazolone, 7-amino-, monohydrochloride
  • 2(3H)-Benzoxazolone, 7-amino-, hydrochloride (1:1)
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.