CymitQuimica logo

CAS 77474-06-7

:

2-[(2-aminophenyl)sulfanyl]ethanol

Description:
2-[(2-Aminophenyl)sulfanyl]ethanol, with the CAS number 77474-06-7, is an organic compound characterized by the presence of both an amino group and a thiol group attached to a two-carbon ethanol backbone. This compound features a phenyl ring substituted with an amino group at the para position relative to the sulfur atom, which is linked to the ethanol moiety. The presence of the amino group imparts basic properties, while the thiol group contributes to its potential reactivity, particularly in redox reactions and the formation of disulfide bonds. The compound is likely to exhibit moderate solubility in polar solvents due to the hydroxyl group, while the aromatic structure may provide some hydrophobic character. Its functional groups suggest potential applications in medicinal chemistry, particularly in the development of pharmaceuticals or as intermediates in organic synthesis. Additionally, the compound may exhibit biological activity, making it of interest in biochemical research. Safety and handling precautions should be observed, as with many organic compounds, due to potential toxicity or reactivity.
Formula:C8H11NOS
InChI:InChI=1/C8H11NOS/c9-7-3-1-2-4-8(7)11-6-5-10/h1-4,10H,5-6,9H2
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.