CAS 77474-50-1

5-fluoro-1-[(2-hydroxyethoxy)methyl]pyrimidine-2,4(1H,3H)-dione

Description:

5-Fluoro-1-[(2-hydroxyethoxy)methyl]pyrimidine-2,4(1H,3H)-dione, with CAS number 77474-50-1, is a chemical compound that belongs to the class of pyrimidine derivatives. It features a fluorine atom at the 5-position of the pyrimidine ring, which can influence its biological activity and pharmacological properties. The presence of a hydroxyethoxy group at the 1-position enhances its solubility and may contribute to its interaction with biological targets. This compound is characterized by its diketone functional groups at the 2 and 4 positions, which can participate in various chemical reactions, including tautomerization and hydrogen bonding. Its structure suggests potential applications in medicinal chemistry, particularly in the development of antiviral or anticancer agents, as pyrimidine derivatives are often explored for such purposes. Additionally, the compound's stability, reactivity, and solubility are influenced by its functional groups, making it a subject of interest in both synthetic and pharmaceutical chemistry.

Formula: C₇H₉FN₂O₄

InChI: InChI=1/C7H9FN2O4/c8-5-3-10(4-14-2-1-11)7(13)9-6(5)12/h3,11H,1-2,4H2,(H,9,12,13)

SMILES: C(COCn1cc(c(nc1=O)O)F)O

Synonyms:

• 1-((2-Hydroxyethoxy)Methyl)-5-Fluorouracil
• 2,4(1H,3H)-pyrimidinedione, 5-fluoro-1-[(2-hydroxyethoxy)methyl]-