CAS 77474-62-5
:3-phenoxyphthalonitrile
Description:
3-Phenoxyphthalonitrile is an organic compound characterized by its structure, which includes a phthalonitrile core substituted with a phenoxy group at the 3-position. This compound typically appears as a solid and is known for its potential applications in materials science, particularly in the synthesis of polymers and as a precursor for various chemical reactions. The presence of the nitrile functional groups contributes to its reactivity, making it useful in forming coordination complexes and in organic synthesis. Additionally, the phenoxy group enhances its solubility in organic solvents, which can be advantageous in various applications. 3-Phenoxyphthalonitrile may exhibit properties such as thermal stability and the ability to participate in cycloaddition reactions, making it a subject of interest in the development of advanced materials. Safety data should be consulted for handling, as with any chemical substance, to ensure proper precautions are taken due to potential toxicity or reactivity.
Formula:C14H8N2O
InChI:InChI=1/C14H8N2O/c15-9-11-5-4-8-14(13(11)10-16)17-12-6-2-1-3-7-12/h1-8H
SMILES:c1ccc(cc1)Oc1cccc(C#N)c1C#N
Synonyms:- 3-Phenoxybenzene-1,2-Dicarbonitrile
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
