CAS 7748-60-9

N-Methyl-6-nitro-1,3-benzodioxol-5-amine

Description:

N-Methyl-6-nitro-1,3-benzodioxol-5-amine, with the CAS number 7748-60-9, is an organic compound characterized by its unique structure that includes a benzodioxole moiety and a nitro group. This compound typically exhibits properties associated with aromatic amines, such as potential solubility in organic solvents and moderate stability under standard conditions. The presence of the nitro group suggests that it may participate in electrophilic aromatic substitution reactions, while the amine functionality can engage in hydrogen bonding, influencing its reactivity and interactions with other molecules. N-Methyl-6-nitro-1,3-benzodioxol-5-amine may also display biological activity, making it of interest in pharmaceutical research. However, specific safety and handling guidelines should be followed due to the potential toxicity associated with nitro compounds and amines. As with many organic compounds, its physical properties, such as melting point and boiling point, would depend on the purity and specific conditions under which it is measured.

Formula: C₈H₈N₂O₄

InChI: InChI=1S/C8H8N2O4/c1-9-5-2-7-8(14-4-13-7)3-6(5)10(11)12/h2-3,9H,4H2,1H3

InChI key: InChIKey=XDVVQLWNXVLLMH-UHFFFAOYSA-N

SMILES: N(C)C=1C=C2C(=CC1N(=O)=O)OCO2

Synonyms:

• 1,3-Benzodioxol-5-amine, N-methyl-6-nitro-
• Aniline, N-methyl-4,5-(methylenedioxy)-2-nitro-
• 5-(Methylamino)-6-nitro-1,3-benzodioxole
• N-Methyl-6-nitro-1,3-benzodioxol-5-amine