CAS 77497-74-6
:(S)-1,2,3,4-Tetrahydro-3-isoquinolinecarboxylicacidt-butylester
Description:
(S)-1,2,3,4-Tetrahydro-3-isoquinolinecarboxylic acid t-butyl ester, with the CAS number 77497-74-6, is a chemical compound characterized by its isoquinoline structure, which is a bicyclic compound featuring a fused benzene and pyridine ring. This compound typically exhibits a chiral center, contributing to its (S)- configuration, which can influence its biological activity and interactions. The presence of the t-butyl ester group enhances its lipophilicity, potentially affecting its solubility and permeability in biological systems. As an ester, it may undergo hydrolysis in the presence of water or biological fluids, leading to the release of the corresponding carboxylic acid. This compound may be of interest in medicinal chemistry, particularly in the development of pharmaceuticals, due to its structural features that can interact with biological targets. Its synthesis and characterization would involve standard organic chemistry techniques, and it may be studied for its pharmacological properties, including potential effects on the central nervous system or other biological pathways.
Formula:C15H19NO4
InChI:InChI=1/C15H19NO4/c1-2-3-8-20-15(19)12-9-10-6-4-5-7-11(10)13(16-12)14(17)18/h4-7,12-13,16H,2-3,8-9H2,1H3,(H,17,18)/t12?,13-/m0/s1
SMILES:CCCCOC(=O)C1Cc2ccccc2[C@@H](C(=O)O)N1
Synonyms:- (S)-1,2,3,4-Tetrahydro-3-Isoquinolinecarboxylic Acid T-Butyl Ester
- (1S)-3-(Butoxycarbonyl)-1,2,3,4-tetrahydroisoquinoline-1-carboxylic acid
- 1,3-isoquinolinedicarboxylic acid, 1,2,3,4-tetrahydro-, 3-butyl ester, (1S)-
- (S)-1,2,3,4-Tetrahydro-3-Isoquinolingcarboxylic Acid tert-butyl ester
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
tert-Butyl (S)-1,2,3,4-tetrahydroisoquinoline-3-carboxylate hydrochloride, 98%
CAS:It is used as a pharmaceutical intermediate. This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as
Formula:C14H19NO2Purity:98%Molecular weight:233.31(S)-1,2,3,4-Tetrahydro-3-isoquinolinecarboxylic acid tert-butyl ester hydrochloride
CAS:Formula:C14H19NO2Purity:99%Color and Shape:SolidMolecular weight:233.3062tert-Butyl (S)-1,2,3,4-tetrahydroisoquinoline-3-carboxylate
CAS:tert-Butyl (S)-1,2,3,4-tetrahydroisoquinoline-3-carboxylatePurity:99%Molecular weight:233.31g/moltert-Butyl (S)-1,2,3,4-tetrahydroisoquinoline-3-carboxylate
CAS:Purity:99%(HPLC);RGMolecular weight:233.3110046



