CAS 775-40-6
:3,3,4,4,5,5,6,6-octafluorocyclohexene
Description:
3,3,4,4,5,5,6,6-octafluorocyclohexene is a fluorinated organic compound characterized by its fully fluorinated cyclohexene structure. This compound features eight fluorine atoms substituting the hydrogen atoms on the cyclohexene ring, resulting in a highly stable and non-polar molecule. Its chemical formula is C6F8, and it is known for its low reactivity due to the strong C-F bonds, which contribute to its thermal and chemical stability. The presence of multiple fluorine atoms imparts unique properties, such as low surface tension and high hydrophobicity, making it useful in various applications, including as a solvent or in specialty coatings. Additionally, 3,3,4,4,5,5,6,6-octafluorocyclohexene exhibits low volatility and is generally considered to have low toxicity, although handling should still be approached with caution due to the potential environmental impact of fluorinated compounds. Its unique characteristics make it a subject of interest in materials science and chemical research.
Formula:C6H2F8
InChI:InChI=1/C6H2F8/c7-3(8)1-2-4(9,10)6(13,14)5(3,11)12/h1-2H
SMILES:C1=CC(C(C(C1(F)F)(F)F)(F)F)(F)F
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.