CAS 775-64-4
:2-(1-Adamantyl)propan-2-ol
Description:
2-(1-Adamantyl)propan-2-ol, with the CAS number 775-64-4, is an organic compound characterized by its unique structure that includes an adamantyl group attached to a propan-2-ol moiety. This compound is a tertiary alcohol, which means it has a hydroxyl (-OH) group bonded to a carbon atom that is connected to three other carbon atoms. The presence of the bulky adamantyl group contributes to its distinctive physical and chemical properties, such as increased steric hindrance, which can influence its reactivity and solubility. Typically, compounds like this exhibit moderate polarity due to the hydroxyl group, allowing for hydrogen bonding, which can affect their boiling and melting points. Additionally, 2-(1-Adamantyl)propan-2-ol may show interesting biological activity, making it a subject of interest in medicinal chemistry. Its synthesis often involves the alkylation of a suitable alcohol or the use of specific reagents to introduce the adamantyl group, highlighting its relevance in organic synthesis and potential applications in pharmaceuticals.
Formula:C13H22O
InChI:InChI=1/C13H22O/c1-12(2,14)13-6-9-3-10(7-13)5-11(4-9)8-13/h9-11,14H,3-8H2,1-2H3
SMILES:CC(C)(C12CC3CC(CC(C3)C2)C1)O
Synonyms:- 2-(1-Adamantyl)-2-propanol
- 2-(Adamantan-1-yl)propan-2-ol
- Tricyclo[3.3.1.1~3,7~]decane-1-methanol, alpha,alpha-dimethyl-
- 2-(Tricyclo[3.3.1.1~3,7~]Dec-1-Yl)Propan-2-Ol
- 2-[1-Adamantyl]propan-2-ol
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
2-(1-Adamantyl)propan-2-ol
CAS:2-(1-Adamantyl)propan-2-ol is an alcohol that can be synthesized in a multistep process. This molecule has been shown to inhibit the influenza virus, which is a type of negative strand RNA virus. It reacts with the sulfide group on the influenza virus, forming a covalent bond. The structure of 2-(1-Adamantyl)propan-2-ol is similar to that of amantadine and azetidine, which are also antiviral drugs used for the treatment of influenza.
Formula:C13H22OPurity:Min. 95%Molecular weight:194.31 g/mol


