CymitQuimica logo

CAS 77505-85-2

:

ethyl 2-amino-5-phenyl-thiazole-4-carboxylate

Description:
Ethyl 2-amino-5-phenyl-thiazole-4-carboxylate is a chemical compound characterized by its thiazole ring, which is a five-membered heterocyclic structure containing sulfur and nitrogen. This compound features an ethyl ester functional group, an amino group, and a phenyl substituent, contributing to its potential biological activity. The presence of the thiazole moiety often indicates properties such as antimicrobial or antifungal activity, making it of interest in pharmaceutical research. The carboxylate group enhances its solubility in polar solvents, which can influence its reactivity and interaction with biological systems. Additionally, the compound's structure suggests it may participate in various chemical reactions, including nucleophilic substitutions and condensation reactions. Its CAS number, 77505-85-2, allows for precise identification in chemical databases, facilitating research and development in medicinal chemistry and related fields. Overall, ethyl 2-amino-5-phenyl-thiazole-4-carboxylate is a versatile compound with potential applications in drug development and synthetic chemistry.
Formula:C12H12N2O2S
InChI:InChI=1/C12H12N2O2S/c1-2-16-11(15)9-10(17-12(13)14-9)8-6-4-3-5-7-8/h3-7H,2H2,1H3,(H2,13,14)
SMILES:CCOC(=O)c1c(c2ccccc2)sc(=N)[nH]1
Synonyms:
  • 4-Thiazolecarboxylic Acid, 2-Amino-5-Phenyl-, Ethyl Ester
  • Ethyl 2-Amino-5-Phenyl-1,3-Thiazole-4-Carboxylate
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.