CAS 77505-90-9

Ethyl 2-amino-5-(3-chlorophenyl)-4-thiazolecarboxylate

Description:

Ethyl 2-amino-5-(3-chlorophenyl)-4-thiazolecarboxylate, with the CAS number 77505-90-9, is a chemical compound that belongs to the thiazole family, characterized by a thiazole ring fused with an amino group and an ethyl ester functional group. This compound typically exhibits properties such as moderate solubility in organic solvents and limited solubility in water, which is common for many thiazole derivatives. The presence of the 3-chlorophenyl group enhances its biological activity, making it of interest in pharmaceutical research, particularly for its potential antimicrobial or anticancer properties. The thiazole ring contributes to its reactivity, allowing for various chemical modifications. Additionally, the compound may display specific spectral characteristics in techniques such as NMR and IR spectroscopy, which can be used for its identification and characterization. Overall, Ethyl 2-amino-5-(3-chlorophenyl)-4-thiazolecarboxylate is a versatile compound with potential applications in medicinal chemistry and material science.

Formula: C₁₂H₁₁ClN₂O₂S

InChI: InChI=1S/C12H11ClN2O2S/c1-2-17-11(16)9-10(18-12(14)15-9)7-4-3-5-8(13)6-7/h3-6H,2H2,1H3,(H2,14,15)

InChI key: InChIKey=PCWLPHQEEGDDTM-UHFFFAOYSA-N

SMILES: C(OCC)(=O)C1=C(SC(N)=N1)C2=CC(Cl)=CC=C2

Synonyms:

• 4-Thiazolecarboxylic acid, 2-amino-5-(3-chlorophenyl)-, ethyl ester
• Ethyl 2-amino-5-(3-chlorophenyl)-4-thiazolecarboxylate