CAS 77516-53-1

N-Cyclohexyl-2-nitrobenzenesulfonamide

Description:

N-Cyclohexyl-2-nitrobenzenesulfonamide is an organic compound characterized by its sulfonamide functional group, which is attached to a nitro-substituted aromatic ring and a cyclohexyl group. This compound typically exhibits properties such as moderate solubility in organic solvents and limited solubility in water, owing to its hydrophobic cyclohexyl moiety and polar sulfonamide group. The presence of the nitro group contributes to its electron-withdrawing characteristics, which can influence its reactivity and interactions in chemical processes. N-Cyclohexyl-2-nitrobenzenesulfonamide may be utilized in various applications, including as a reagent in organic synthesis or as a potential pharmaceutical intermediate. Its biological activity can be influenced by the structural features, making it of interest in medicinal chemistry. Safety data should be consulted for handling and usage, as sulfonamides can have specific health and environmental considerations. Overall, this compound represents a unique combination of functional groups that can lead to diverse chemical behavior and applications.

Formula: C₁₂H₁₆N₂O₄S

InChI: InChI=1S/C12H16N2O4S/c15-14(16)11-8-4-5-9-12(11)19(17,18)13-10-6-2-1-3-7-10/h4-5,8-10,13H,1-3,6-7H2

InChI key: InChIKey=MLDBPBAIRZLOJF-UHFFFAOYSA-N

SMILES: S(NC1CCCCC1)(=O)(=O)C2=C(N(=O)=O)C=CC=C2

Synonyms:

• N-Cyclohexyl-2-nitrobenzenesulfonamide
• Benzenesulfonamide, N-cyclohexyl-2-nitro-