CAS 77527-97-0
:(2E)-N-Methyl-3-phenyl-N-[(1E)-2-phenylethenyl]-2-propenamide
Description:
(2E)-N-Methyl-3-phenyl-N-[(1E)-2-phenylethenyl]-2-propenamide, with the CAS number 77527-97-0, is an organic compound characterized by its amide functional group and a complex structure featuring both phenyl and propenamide moieties. This compound exhibits a double bond configuration, indicated by the (2E) and (1E) designations, which suggest specific geometric isomerism that can influence its reactivity and interactions. The presence of the N-methyl group contributes to its overall polarity and solubility characteristics, while the phenyl groups enhance its aromatic properties, potentially affecting its stability and reactivity in various chemical environments. Such compounds may exhibit biological activity, making them of interest in medicinal chemistry and drug design. Additionally, the structural features suggest potential for various synthetic applications, including use as intermediates in organic synthesis. Understanding the physical and chemical properties, such as melting point, boiling point, and solubility, would require experimental data, but the compound's structure indicates it may participate in typical reactions associated with amides and alkenes.
Formula:C18H17NO
InChI:InChI=1S/C18H17NO/c1-19(15-14-17-10-6-3-7-11-17)18(20)13-12-16-8-4-2-5-9-16/h2-15H,1H3/b13-12+,15-14+
InChI key:InChIKey=VJGRWRRIAJQNFU-SQIWNDBBSA-N
SMILES:C(=C/C(N(/C=C/C1=CC=CC=C1)C)=O)\C2=CC=CC=C2
Synonyms:- 2-Propenamide, N-methyl-3-phenyl-N-[(1E)-2-phenylethenyl]-, (2E)-
- Lansamide
- (2E)-N-Methyl-3-phenyl-N-[(1E)-2-phenylethenyl]-2-propenamide
- Lansamide I
- 2-Propenamide, N-methyl-3-phenyl-N-(2-phenylethenyl)-, (E,E)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
