CymitQuimica logo

CAS 77528-47-3

:

4,5,6,7-Tetrahydro-4-benzothiazolemethanol

Description:
4,5,6,7-Tetrahydro-4-benzothiazolemethanol is a chemical compound characterized by its unique bicyclic structure, which includes a benzothiazole moiety. This compound features a tetrahydrobenzothiazole ring, indicating that it has undergone partial hydrogenation, resulting in a saturated structure. The presence of a hydroxymethyl group (-CH2OH) contributes to its reactivity and potential solubility in polar solvents. Typically, compounds like this may exhibit biological activity, making them of interest in medicinal chemistry and pharmacology. The benzothiazole framework is known for its diverse applications, including use in dyes, pharmaceuticals, and agrochemicals. Additionally, the compound's properties, such as melting point, boiling point, and solubility, can vary based on its specific interactions with solvents and other chemical entities. Safety data and handling precautions should be consulted, as with any chemical substance, to ensure proper usage and minimize risks. Overall, 4,5,6,7-Tetrahydro-4-benzothiazolemethanol represents a fascinating area of study within organic chemistry and its applications.
Formula:C8H11NOS
InChI:InChI=1S/C8H11NOS/c10-4-6-2-1-3-7-8(6)9-5-11-7/h5-6,10H,1-4H2
InChI key:InChIKey=OPITVRBXKRIOFT-UHFFFAOYSA-N
SMILES:C(O)C1C2=C(SC=N2)CCC1
Synonyms:
  • 4,5,6,7-Tetrahydro-4-benzothiazolemethanol
  • 4-Benzothiazolemethanol, 4,5,6,7-tetrahydro-
  • (4,5,6,7-Tetrahydrobenzo[d]thiazol-4-yl)methanol
  • (4,5,6,7-Tetrahydro-1,3-benzothiazol-4-yl)methanol
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.