
CAS 77528-67-7
:4,5,6,7-Tetrahydro-N,2-dimethyl-5-benzothiazolemethanamine
Description:
4,5,6,7-Tetrahydro-N,2-dimethyl-5-benzothiazolemethanamine, with the CAS number 77528-67-7, is a chemical compound characterized by its unique bicyclic structure that incorporates a benzothiazole moiety. This compound features a tetrahydro configuration, indicating the presence of a saturated ring system, which contributes to its stability and reactivity. The dimethyl substitution at the nitrogen atom enhances its lipophilicity, potentially influencing its biological activity and solubility in organic solvents. The benzothiazole component is known for its diverse applications in pharmaceuticals and agrochemicals, often exhibiting antimicrobial and anti-inflammatory properties. The presence of the amine functional group suggests that this compound may participate in various chemical reactions, including alkylation and acylation, making it a versatile intermediate in synthetic chemistry. Overall, the structural features of this compound suggest potential utility in medicinal chemistry, although specific applications would depend on further research into its biological properties and interactions.
Formula:C10H16N2S
InChI:InChI=1S/C10H16N2S/c1-7-12-9-5-8(6-11-2)3-4-10(9)13-7/h8,11H,3-6H2,1-2H3
InChI key:InChIKey=OFSPYMGCSOTXQN-UHFFFAOYSA-N
SMILES:CC=1SC2=C(CC(CNC)CC2)N1
Synonyms:- Manozodil
- 5-Benzothiazolemethanamine, 4,5,6,7-tetrahydro-N,2-dimethyl-
- 4,5,6,7-Tetrahydro-N,2-dimethyl-5-benzothiazolemethanamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.