CAS 775288-71-6
:1-(6-nitropyridin-3-yl)piperazine
Description:
1-(6-Nitropyridin-3-yl)piperazine is a chemical compound characterized by its piperazine core, which is a six-membered ring containing two nitrogen atoms. The compound features a nitro group (-NO2) and a pyridine ring, specifically a 6-nitropyridine, which is substituted at the 3-position of the piperazine. This structural arrangement contributes to its potential biological activity, making it of interest in medicinal chemistry and pharmacology. The presence of the nitro group can influence the compound's electronic properties, solubility, and reactivity. Typically, compounds like this may exhibit various pharmacological effects, including potential use as a drug or in research applications. Its molecular structure allows for interactions with biological targets, which can be explored in drug development. As with many nitrogen-containing heterocycles, it may also exhibit properties such as basicity and the ability to form salts. Safety and handling precautions are essential when working with this compound, as nitro-substituted compounds can sometimes be sensitive or toxic.
Formula:C9H12N4O2
InChI:InChI=1/C9H12N4O2/c14-13(15)9-2-1-8(7-11-9)12-5-3-10-4-6-12/h1-2,7,10H,3-6H2
SMILES:c1cc(ncc1N1CCNCC1)N(=O)=O
Synonyms:- 1-(6-Nitropyridin-3-yl)piperazin
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
1-(6-NITROPYRIDIN-3-YL)PIPERAZINE
CAS:Formula:C9H12N4O2Purity:98%Color and Shape:SolidMolecular weight:208.21721-(6-Nitropyridin-3-yl)piperazine
CAS:1-(6-Nitropyridin-3-yl)piperazinePurity:99%Molecular weight:208.22g/mol1-(6-Nitropyridin-3-yl)piperazine
CAS:Formula:C9H12N4O2Purity:98%Color and Shape:SolidMolecular weight:208.2211-(6-Nitropyridin-3-yl)piperazine
CAS:1-(6-Nitropyridin-3-yl)piperazine is a tosylate of piperazine that can be used for radiolabeling. It has been shown to react with aziridine and form 1-(6-nitropyridin-3-yl)aziridine in the presence of isopropyl alcohol, yielding a mixture of isomers. This reaction has also been shown to proceed with isobutanol as solvent. The yield was dependent on the concentration of piperazine, but was greater when using higher concentrations. The experimentally determined rate constants and activation energies for this reaction were found to be 0.0074 M−1s−1 and −10.8 kJ/mol, respectively. This chemical can be used as a substrate for kinases or solvents in liquid chromatography, diluent in affinity chromatography, or reversed phase chromatography experiments.br> br>Formula:C9H12N4O2Purity:Min. 95%Molecular weight:208.22 g/mol





