CAS 77529-42-1
:4-(4'-bromobiphenyl-4-yl)-5-hydroxy-1H-pyrrole-2,3-dione
Description:
4-(4'-Bromobiphenyl-4-yl)-5-hydroxy-1H-pyrrole-2,3-dione, with the CAS number 77529-42-1, is a synthetic organic compound characterized by its complex structure, which includes a pyrrole ring substituted with a hydroxyl group and a biphenyl moiety that contains a bromine atom. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, such as stability and potential reactivity due to the presence of the hydroxyl and carbonyl functional groups. The bromine substituent can influence its electronic properties, making it useful in various applications, including organic electronics and as a potential intermediate in organic synthesis. Additionally, the presence of the hydroxyl group may impart solubility in polar solvents and enhance its reactivity in chemical transformations. Overall, this compound's unique structural features contribute to its potential utility in research and industrial applications, particularly in the fields of materials science and medicinal chemistry.
Formula:C16H10BrNO3
InChI:InChI=1/C16H10BrNO3/c17-12-7-5-10(6-8-12)9-1-3-11(4-2-9)13-14(19)16(21)18-15(13)20/h1-8H,(H2,18,19,20,21)
SMILES:c1cc(ccc1c1ccc(cc1)Br)C1=C(C(=O)N=C1O)O
Synonyms:- 1H-Pyrrole-2,5-dione, 3-(4'-bromo[1,1'-biphenyl]-4-yl)-4-hydroxy-
- Glycolic acid oxidase inhibitor 1
- 3-[4'-Bromo(1,1'-biphenyl)-4-yl]-4-hydroxy-1H-pyrrole-2,5-dione
- BRN 4488383
- 4-(4'-Bromo-4-biphenylyl)-5-hydroxy-1H-pyrrole-2,3-dione
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
Glycolic acid oxidase inhibitor 1
CAS:Glycolic acid oxidase inhibitor 1Formula:C16H10BrNO3Purity:≥95%Molecular weight:344.16Glycolic acid oxidase inhibitor 1
CAS:Glycolate is a chemical compound that is found in the leaves of beans and other plants. Glycolate is oxidized by glycolic acid oxidase (GAO) to form glyoxylic acid, which is then converted to glyoxylate by GAO. Glyoxylate can be converted to glycine, an amino acid that helps with protein synthesis, or it can be converted to oxalate, a toxin. Glycolic acid oxidase inhibitor 1 (GAOI-1) prevents the oxidation of glycolate into glyoxylic acid by stopping the cycle of GAO. GAOI-1 binds to one of the intermediate products in this cycle and inhibits its activity. It has been shown to reduce leaf tissue damage caused by high levels of photosynthesis.
Formula:C16H10BrNO3Purity:Min. 95%Molecular weight:344.16 g/molGlycolic acid oxidase inhibitor 1
CAS:Glycolic acid oxidase inhibitor 1 reduces the risk of kidney stone formation. allergic diseases such as asthma.Formula:C16H10BrNO3Color and Shape:SolidMolecular weight:344.16



