CAS 775293-37-3
:4-{[(thiophen-2-ylmethyl)amino]methyl}benzoic acid
Description:
4-{[(Thiophen-2-ylmethyl)amino]methyl}benzoic acid, with the CAS number 775293-37-3, is a chemical compound characterized by its unique structure, which includes a benzoic acid moiety substituted with a thiophen-2-ylmethyl amino group. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, such as stability and potential for various chemical interactions. The presence of the thiophene ring contributes to its electronic properties, potentially enhancing its reactivity and solubility in organic solvents. The carboxylic acid functional group in the benzoic acid portion allows for hydrogen bonding and can influence the compound's acidity and solubility in aqueous environments. This compound may be of interest in pharmaceutical research due to its potential biological activity, particularly in the development of new therapeutic agents. Its synthesis and characterization would involve standard organic chemistry techniques, and its applications could span across medicinal chemistry, materials science, and organic synthesis.
Formula:C13H13NO2S
InChI:InChI=1/C13H13NO2S/c15-13(16)11-5-3-10(4-6-11)8-14-9-12-2-1-7-17-12/h1-7,14H,8-9H2,(H,15,16)
SMILES:c1cc(CNCc2ccc(cc2)C(=O)O)sc1
Synonyms:- 4-{[(2-Thienylmethyl)amino]methyl}benzoic acid
- Benzoic Acid, 4-[[(2-Thienylmethyl)Amino]Methyl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.