CAS 775302-22-2

2-(2-methylphenyl)-1,3-benzoxazol-6-amine

Description:

2-(2-Methylphenyl)-1,3-benzoxazol-6-amine is an organic compound characterized by its complex structure, which includes a benzoxazole ring fused with an aniline moiety. The presence of the 2-methylphenyl group contributes to its hydrophobic characteristics, while the amine functional group can engage in hydrogen bonding, influencing its solubility and reactivity. This compound typically exhibits a solid state at room temperature and may have moderate to high melting and boiling points, depending on its molecular interactions. Its chemical properties suggest potential applications in pharmaceuticals, particularly in the development of biologically active compounds, due to the presence of both aromatic and amine functionalities. Additionally, the compound may exhibit fluorescence properties, making it of interest in materials science and organic electronics. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken.

Formula: C₁₄H₁₂N₂O

InChI: InChI=1/C14H12N2O/c1-9-4-2-3-5-11(9)14-16-12-7-6-10(15)8-13(12)17-14/h2-8H,15H2,1H3

SMILES: Cc1ccccc1c1nc2ccc(cc2o1)N

Synonyms:

• 6-Benzoxazolamine, 2-(2-Methylphenyl)-