CAS 775351-30-9

[3-(1H-tetrazol-5-yl)phenyl]boronic acid

Description:

[3-(1H-tetrazol-5-yl)phenyl]boronic acid is an organoboron compound characterized by the presence of a boronic acid functional group and a tetrazole moiety. This compound typically exhibits properties such as being a white to off-white solid, soluble in polar solvents like water and methanol, and possessing moderate stability under standard laboratory conditions. The boronic acid group allows for the formation of reversible covalent bonds with diols, making it useful in various applications, including organic synthesis and medicinal chemistry. The tetrazole ring contributes to its potential biological activity, as tetrazoles are known for their pharmacological properties. Additionally, this compound may participate in Suzuki-Miyaura cross-coupling reactions, which are essential in the formation of carbon-carbon bonds in organic synthesis. Its unique structural features and reactivity make it a valuable intermediate in the development of pharmaceuticals and agrochemicals. As with many boronic acids, care should be taken in handling due to potential reactivity with moisture and other nucleophiles.

Formula: C₇H₇BN₄O₂

InChI: InChI=1/C7H7BN4O2/c13-8(14)6-3-1-2-5(4-6)7-9-11-12-10-7/h1-4,13-14H,(H,9,10,11,12)

SMILES: c1cc(cc(c1)B(O)O)c1n[nH]nn1

Synonyms:

• 3-(2H-Tetrazol-5-Yl)-Phenyl-Boronic Acid

3-(1H-Tetrazol-5-yl)phenylboronic Acid

CAS: 775351-30-9

Formula: C₇H₇BN₄O₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 189.9671

Ref: IN-DA008OW8

3-(2H-Tetrazol-5-yl)phenyl-boronic acid

CAS: 775351-30-9

Formula: C₇H₇BN₄O₂

Purity: 97.0%

Molecular weight: 189.97

Ref: 10-F493619