CAS 775351-57-0
:2-fluoro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzonitrile
Description:
2-Fluoro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzonitrile is an organic compound characterized by its unique structure, which includes a fluorine atom and a dioxaborolane moiety. The presence of the fluorine atom typically enhances the compound's reactivity and can influence its electronic properties, making it useful in various chemical applications. The dioxaborolane group is known for its stability and ability to participate in boron chemistry, often serving as a versatile building block in organic synthesis. This compound may exhibit properties such as moderate solubility in organic solvents and potential utility in medicinal chemistry or materials science due to its functional groups. Additionally, the presence of the benzonitrile moiety suggests potential applications in the synthesis of pharmaceuticals or agrochemicals. Overall, the combination of these functional groups contributes to the compound's reactivity and applicability in various chemical contexts.
Formula:C13H15BFNO2
InChI:InChI=1/C13H15BFNO2/c1-12(2)13(3,4)18-14(17-12)10-5-6-11(15)9(7-10)8-16/h5-7H,1-4H3
InChI key:InChIKey=RYJOVQGRIOURGT-UHFFFAOYSA-N
SMILES:CC1(C)OB(OC1(C)C)C2=CC(C#N)=C(F)C=C2
Synonyms:- 2-Fluoro-5-(tetramethyl-1,3,2-dioxaborolan-2-yl)benzonitrile
- 3-Cyano-4-Fluorophenylboronic Acid, Pinacol Ester
- Benzonitrile, 2-fluoro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-
- 2-Fluoro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzonitrile
- 2-(3-Cyano-4-fluorophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane
- 5-Cyano-2-fluorobenzeneboronic acid pinacol ester, 96%
- Bm369
- 3-Cyano-4-fluorophenylboronic acid, pinacol ester 95+%
- 3-Cyano-4-fluorobenzeneboronic acid pinacol ester, 96%
- 2-fluoro-5-(tetraMethyl-1,3,2-dioxaborolan-2-yl)benzonitri
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
3-Cyano-4-fluorobenzeneboronic acid pinacol ester, 96%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo SciFormula:C13H15BFNO2Purity:96%Molecular weight:247.073-CYANO-4-FLUOROPHENYLBORONIC ACID, PINACOL ESTER
CAS:Formula:C13H15BFNO2Purity:98%Color and Shape:SolidMolecular weight:247.07313-Cyano-4-fluorophenylboronic acid, pinacol ester
CAS:3-Cyano-4-fluorophenylboronic acid, pinacol esterPurity:98%Molecular weight:247.07g/mol2-Fluoro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzonitrile
CAS:Formula:C13H15BFNO2Purity:>98.0%(GC)Color and Shape:White to Almost white powder to crystalMolecular weight:247.083-Cyano-4-fluorophenylboronic acid pinacol ester
CAS:Formula:C13H15BFNO2Purity:95%Color and Shape:SolidMolecular weight:247.08





