CAS 77541-65-2
:2-benzyl-5-chloro-4-methoxy-pyridazin-3-one
Description:
2-benzyl-5-chloro-4-methoxy-pyridazin-3-one is a chemical compound characterized by its pyridazine core, which is a six-membered heterocyclic ring containing two nitrogen atoms. This compound features a benzyl group, a chlorine atom, and a methoxy group, contributing to its unique chemical properties. The presence of the chlorine atom typically enhances the compound's reactivity, while the methoxy group can influence its solubility and polarity. The benzyl substituent can provide additional stability and may affect the compound's biological activity. In terms of applications, compounds like this may be explored for their potential in pharmaceuticals or agrochemicals due to their structural characteristics. The molecular structure suggests potential interactions with biological targets, making it of interest in medicinal chemistry. However, specific properties such as melting point, boiling point, and solubility would require empirical data for precise characterization. Safety and handling precautions should be observed, as with any chemical substance, particularly those with halogen substituents.
Formula:C12H11ClN2O2
InChI:InChI=1/C12H11ClN2O2/c1-17-11-10(13)7-14-15(12(11)16)8-9-5-3-2-4-6-9/h2-7H,8H2,1H3
SMILES:COc1c(cnn(Cc2ccccc2)c1=O)Cl
Synonyms:- 2-Benzyl-5-chloro-4-methoxypyridazin-3(2H)-one
- 3(2H)-pyridazinone, 5-chloro-4-methoxy-2-(phenylmethyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
2-Benzyl-5-chloro-4-methoxy-2H-pyridazin-3-one
CAS:2-Benzyl-5-chloro-4-methoxy-2H-pyridazin-3-one
Molecular weight:250.68g/mol
