CymitQuimica logo

CAS 77544-61-7

:

2-[2-[2-[2-(8-Quinolinyloxy)ethoxy]ethoxy]ethoxy]ethanol

Description:
2-[2-[2-[2-(8-Quinolinyloxy)ethoxy]ethoxy]ethoxy]ethanol, with CAS number 77544-61-7, is a complex organic compound characterized by its multi-ethoxy functional groups and a quinoline moiety. This substance features a long carbon chain that includes four ethoxy groups, which contribute to its solubility in organic solvents and potential applications in various chemical processes. The presence of the quinoline structure imparts unique properties, including potential biological activity, as quinoline derivatives are known for their roles in medicinal chemistry. The compound is likely to exhibit moderate to high polarity due to the hydroxyl group and ethoxy chains, influencing its interactions in biological systems and chemical reactions. Additionally, the compound may have applications in fields such as pharmaceuticals, materials science, or as a reagent in organic synthesis. However, specific safety and handling information should be consulted, as with any chemical substance, to ensure proper usage and compliance with regulatory standards.
Formula:C17H23NO5
InChI:InChI=1S/C17H23NO5/c19-7-8-20-9-10-21-11-12-22-13-14-23-16-5-1-3-15-4-2-6-18-17(15)16/h1-6,19H,7-14H2
InChI key:InChIKey=MDUKDRSQQGOURG-UHFFFAOYSA-N
SMILES:O(CCOCCOCCOCCO)C=1C2=C(C=CC1)C=CC=N2
Synonyms:
  • 2-[2-[2-[2-(8-Quinolinyloxy)ethoxy]ethoxy]ethoxy]ethanol
  • Ethanol, 2-[2-[2-[2-(8-quinolinyloxy)ethoxy]ethoxy]ethoxy]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.