CAS 77547-11-6

4-(1-Pyrrolidinylsulfonyl)benzaldehyde

Description:

4-(1-Pyrrolidinylsulfonyl)benzaldehyde, with the CAS number 77547-11-6, is an organic compound characterized by the presence of a benzaldehyde moiety substituted with a pyrrolidinylsulfonyl group. This compound typically exhibits a white to off-white crystalline appearance. It is soluble in polar organic solvents, which is common for compounds containing sulfonyl groups. The presence of the pyrrolidinyl group suggests potential interactions with biological systems, making it of interest in medicinal chemistry. The sulfonyl functional group can enhance the compound's reactivity and solubility, while the aldehyde group may participate in various chemical reactions, such as nucleophilic additions. Additionally, this compound may exhibit specific pharmacological properties, although detailed biological activity would require further investigation. Its structural features suggest potential applications in drug development, particularly in the synthesis of more complex molecules or as a building block in organic synthesis. Safety and handling precautions should be observed, as with any chemical substance, due to potential toxicity or reactivity.

Formula: C₁₁H₁₃NO₃S

InChI: InChI=1S/C11H13NO3S/c13-9-10-3-5-11(6-4-10)16(14,15)12-7-1-2-8-12/h3-6,9H,1-2,7-8H2

InChI key: InChIKey=NUPJAARWSKKWBR-UHFFFAOYSA-N

SMILES: S(=O)(=O)(C1=CC=C(C=O)C=C1)N2CCCC2

Synonyms:

• Pyrrolidine, 1-[(4-formylphenyl)sulfonyl]-
• 4-(1-Pyrrolidinylsulfonyl)benzaldehyde
• Benzaldehyde, 4-(1-pyrrolidinylsulfonyl)-
• 4-(Pyrrolidin-1-ylsulfonyl)benzaldehyde
• 4-(Pyrrolidine-1-sulfonyl)-benzaldehyde