
CAS 7755-93-3
:3-(2-Pyridinyl)-2(1H)-quinoxalinone
Description:
3-(2-Pyridinyl)-2(1H)-quinoxalinone, identified by the CAS number 7755-93-3, is a heterocyclic organic compound characterized by its fused ring structure, which includes both a quinoxalinone and a pyridine moiety. This compound typically exhibits properties such as moderate solubility in organic solvents and potential biological activity, making it of interest in medicinal chemistry. The presence of nitrogen atoms in its structure contributes to its ability to form hydrogen bonds, influencing its reactivity and interaction with biological targets. Additionally, the compound may display fluorescence properties, which can be useful in various analytical applications. Its unique structure allows for potential applications in drug development, particularly in targeting specific enzymes or receptors. Overall, 3-(2-Pyridinyl)-2(1H)-quinoxalinone is a versatile compound with significant implications in both research and pharmaceutical contexts.
Formula:C13H9N3O
InChI:InChI=1S/C13H9N3O/c17-13-12(11-7-3-4-8-14-11)15-9-5-1-2-6-10(9)16-13/h1-8H,(H,16,17)
InChI key:InChIKey=NTNWESIGXKNYPE-UHFFFAOYSA-N
SMILES:O=C1C(=NC=2C(N1)=CC=CC2)C3=CC=CC=N3
Synonyms:- 2(1H)-Quinoxalinone, 3-(2-pyridinyl)-
- 3-Pyridin-2-yl-1H-quinoxalin-2-one
- 3-(2-Pyridinyl)-2(1H)-quinoxalinone
- 2(1H)-Quinoxalinone, 3-(2-pyridyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.