CAS 77557-02-9

1-Butyl-1,3-dihydro-2H-benzimidazol-2-one

Description:

1-Butyl-1,3-dihydro-2H-benzimidazol-2-one, identified by its CAS number 77557-02-9, is a chemical compound that belongs to the class of benzimidazoles, which are known for their diverse biological activities. This substance features a butyl group attached to the nitrogen of the benzimidazole ring, contributing to its lipophilicity and potential for biological interactions. The compound typically exhibits a solid state at room temperature and is soluble in organic solvents, which is characteristic of many benzimidazole derivatives. Its structure includes a bicyclic system that can participate in various chemical reactions, making it of interest in medicinal chemistry and material science. The presence of the dihydro group suggests that it may undergo oxidation or other transformations under certain conditions. Additionally, compounds in this class are often studied for their pharmacological properties, including antimicrobial and antifungal activities, although specific biological data for this compound may vary. Overall, 1-butyl-1,3-dihydro-2H-benzimidazol-2-one represents a versatile scaffold for further research and development in various chemical applications.

Formula: C₁₁H₁₄N₂O

InChI: InChI=1S/C11H14N2O/c1-2-3-8-13-10-7-5-4-6-9(10)12-11(13)14/h4-7H,2-3,8H2,1H3,(H,12,14)

InChI key: InChIKey=IDAMRRQTIRIFIA-UHFFFAOYSA-N

SMILES: C(CCC)N1C=2C(NC1=O)=CC=CC2

Synonyms:

• 2-Benzimidazolinone, 1-butyl-
• 2H-Benzimidazol-2-one, 1-butyl-1,3-dihydro-
• 1-Butyl-1,3-dihydro-benzoimidazol-2-one
• 1-Butyl-1,3-dihydro-2H-benzimidazol-2-one
• 1-Butyl-1H-1,3-benzodiazol-2-ol