CAS 7756-78-7

2-methyl-2-(naphthalen-2-yloxy)propanoic acid

Description:

2-Methyl-2-(naphthalen-2-yloxy)propanoic acid, with the CAS number 7756-78-7, is an organic compound characterized by its unique structure that includes a naphthalene moiety and a propanoic acid functional group. This compound typically exhibits properties associated with both aromatic and aliphatic compounds, such as moderate solubility in organic solvents and potential reactivity due to the presence of the carboxylic acid group. The naphthalene ring contributes to its hydrophobic characteristics, while the propanoic acid portion provides acidic properties. This compound may be utilized in various applications, including pharmaceuticals and agrochemicals, due to its potential biological activity. Its synthesis often involves the reaction of naphthalene derivatives with appropriate alkylating agents, followed by functional group transformations. Safety data sheets should be consulted for handling and storage guidelines, as with any chemical substance, to ensure safe laboratory practices. Overall, 2-methyl-2-(naphthalen-2-yloxy)propanoic acid represents a versatile compound in organic chemistry with interesting properties and applications.

Formula: C₁₄H₁₄O₃

InChI: InChI=1/C14H14O3/c1-14(2,13(15)16)17-12-8-7-10-5-3-4-6-11(10)9-12/h3-9H,1-2H3,(H,15,16)

SMILES: CC(C)(C(=O)O)Oc1ccc2ccccc2c1

Synonyms:

• 2-Methyl-2-(2-naphthyloxy)propanoic acid
• Propanoic Acid, 2-Methyl-2-(2-Naphthalenyloxy)-

2-METHYL-2-(2-NAPHTHYLOXY)PROPANOIC ACID

CAS: 7756-78-7

Formula: C₁₄H₁₄O₃

Purity: 95%

Color and Shape: Solid

Molecular weight: 230.2592

Ref: IN-DA005SN0

2-methyl-2-(2-naphthyloxy)propanoic acid

CAS: 7756-78-7

Formula: C₁₄H₁₄O₃

Purity: 95.0%

Molecular weight: 230.263

Ref: 10-F307527