CAS 7756-87-8
:1,3-Dichloro-1,1,3,3-tetraphenyldisiloxane
Description:
1,3-Dichloro-1,1,3,3-tetraphenyldisiloxane is an organosilicon compound characterized by its unique siloxane backbone, which consists of silicon-oxygen (Si-O) linkages. This compound features two silicon atoms, each bonded to phenyl groups and chlorine substituents, contributing to its distinctive chemical properties. It is typically a colorless to pale yellow liquid or solid, depending on its specific formulation and purity. The presence of chlorine atoms enhances its reactivity, making it useful in various chemical applications, including as a precursor in the synthesis of silicone polymers and as a potential intermediate in organic synthesis. Additionally, the phenyl groups provide stability and influence the compound's solubility in organic solvents. 1,3-Dichloro-1,1,3,3-tetraphenyldisiloxane is also noted for its thermal stability and resistance to degradation, which are important characteristics for its use in high-performance materials. Safety considerations should be taken into account due to the presence of chlorine, which can pose health and environmental risks.
Formula:C24H20Cl2OSi2
InChI:InChI=1S/C24H20Cl2OSi2/c25-28(21-13-5-1-6-14-21,22-15-7-2-8-16-22)27-29(26,23-17-9-3-10-18-23)24-19-11-4-12-20-24/h1-20H
InChI key:InChIKey=YQULWRCMYAXEAV-UHFFFAOYSA-N
SMILES:[Si](O[Si](Cl)(C1=CC=CC=C1)C2=CC=CC=C2)(Cl)(C3=CC=CC=C3)C4=CC=CC=C4
Synonyms:- 1,1,1,5,5,5-Hexamethyldiphenyltrisiloxane
- 1,3-Dichloro-1,1,3,3-tetraphenyldisiloxane
- Disiloxane, 1,3-dichloro-1,1,3,3-tetraphenyl-
- 1,3-Dichlorotetraphenyldisiloxane
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.