CymitQuimica logo

CAS 77573-84-3

:

17-Hydroxy-3,6,9,12,15-pentaoxaheptadec-1-yl 2-propenoate

Description:
17-Hydroxy-3,6,9,12,15-pentaoxaheptadec-1-yl 2-propenoate, with the CAS number 77573-84-3, is a chemical compound characterized by its unique structure, which includes a long hydrophilic polyether chain and an ester functional group. This compound features multiple ether linkages, contributing to its solubility in polar solvents and potential applications in various fields, including pharmaceuticals and materials science. The presence of the 2-propenoate moiety suggests that it can undergo polymerization, making it useful in the synthesis of polymers or as a monomer in various chemical reactions. Its hydroxyl group may also provide sites for further chemical modifications, enhancing its versatility. The compound's properties, such as melting point, boiling point, and reactivity, would depend on its molecular interactions and the specific conditions under which it is used. Overall, this compound exemplifies the intersection of organic chemistry and materials science, with potential applications in drug delivery systems and advanced materials.
Formula:C15H28O8
InChI:InChI=1S/C15H28O8/c1-2-15(17)23-14-13-22-12-11-21-10-9-20-8-7-19-6-5-18-4-3-16/h2,16H,1,3-14H2
InChI key:InChIKey=UHBKLFLAVYCZEP-UHFFFAOYSA-N
SMILES:O(CCOCCOCCOCCOCCO)CCOC(C=C)=O
Synonyms:
  • Hexaethylene glycol monoacrylate
  • 2-Propenoic acid, 17-hydroxy-3,6,9,12,15-pentaoxaheptadec-1-yl ester
  • 17-Hydroxy-3,6,9,12,15-pentaoxaheptadec-1-yl 2-propenoate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.