CAS 77591-33-4
:Thymosin beta 4 acetate
Description:
Thymosin beta 4 acetate is a peptide that plays a significant role in various biological processes, particularly in cell migration, wound healing, and tissue repair. It is derived from thymosin beta 4, a naturally occurring protein found in many tissues, and is known for its ability to promote actin polymerization, which is crucial for cell movement and structural integrity. The acetate form enhances its solubility and stability, making it suitable for research and potential therapeutic applications. Thymosin beta 4 acetate has been studied for its anti-inflammatory properties and its potential to accelerate healing in various injuries, including skin and cardiac tissues. It is often utilized in experimental settings to explore its effects on cell behavior and regeneration. The substance is typically administered in a controlled manner in laboratory environments, and while it shows promise in regenerative medicine, further research is necessary to fully understand its mechanisms and potential clinical applications.
Formula:C212H350N56O78S
InChI:InChI=1/C212H350N56O78S/c1-16-106(7)166(261-190(323)131(64-75-160(292)293)231-172(305)109(10)228-174(307)134(78-91-347-15)245-196(329)140(98-165(302)303)255-201(334)147-53-39-88-266(147)209(342)135(52-29-38-87-221)250-197(330)139(97-164(300)301)254-198(331)143(100-269)229-113(14)276)204(337)246-129(62-73-158(288)289)187(320)233-118(47-24-33-82-216)179(312)252-137(94-114-42-19-18-20-43-114)194(327)253-138(96-163(298)299)195(328)237-121(50-27-36-85-219)181(314)258-144(101-270)199(332)239-119(48-25-34-83-217)178(311)251-136(92-104(3)4)193(326)236-116(45-22-31-80-214)175(308)235-122(51-28-37-86-220)189(322)263-168(110(11)273)207(340)249-133(66-77-162(296)297)192(325)264-169(111(12)274)206(339)248-126(58-69-152(224)279)184(317)243-128(61-72-157(286)287)186(319)234-120(49-26-35-84-218)180(313)256-142(95-153(225)280)211(344)268-90-40-54-148(268)202(335)257-141(93-105(5)6)210(343)267-89-41-55-149(267)203(336)259-145(102-271)200(333)238-117(46-23-32-81-215)177(310)244-132(65-76-161(294)295)191(324)265-170(112(13)275)208(341)262-167(107(8)17-2)205(338)247-130(63-74-159(290)291)188(321)241-125(57-68-151(223)278)183(316)242-127(60-71-156(284)285)185(318)232-115(44-21-30-79-213)176(309)240-124(56-67-150(222)277)173(306)227-108(9)171(304)226-99-154(281)230-123(59-70-155(282)283)182(315)260-146(103-272)212(345)346/h18-20,42-43,104-112,115-149,166-170,269-275H,16-17,21-41,44-103,213-221H2,1-15H3,(H2,222,277)(H2,223,278)(H2,224,279)(H2,225,280)(H,226,304)(H,227,306)(H,228,307)(H,229,276)(H,230,281)(H,231,305)(H,232,318)(H,233,320)(H,234,319)(H,235,308)(H,236,326)(H,237,328)(H,238,333)(H,239,332)(H,240,309)(H,241,321)(H,242,316)(H,243,317)(H,244,310)(H,245,329)(H,246,337)(H,247,338)(H,248,339)(H,249,340)(H,250,330)(H,251,311)(H,252,312)(H,253,327)(H,254,331)(H,255,334)(H,256,313)(H,257,335)(H,258,314)(H,259,336)(H,260,315)(H,261,323)(H,262,341)(H,263,322)(H,264,325)(H,265,324)(H,282,283)(H,284,285)(H,286,287)(H,288,289)(H,290,291)(H,292,293)(H,294,295)(H,296,297)(H,298,299)(H,300,301)(H,302,303)(H,345,346)
SMILES:CCC(C)C(C(=NC(CCC(=O)O)C(=NC(CCCCN)C(=NC(Cc1ccccc1)C(=NC(CC(=O)O)C(=NC(CCCCN)C(=NC(CO)C(=NC(CCCCN)C(=NC(CC(C)C)C(=NC(CCCCN)C(=NC(CCCCN)C(=NC(C(C)O)C(=NC(CCC(=O)O)C(=NC(C(C)O)C(=NC(CCC(=N)O)C(=NC(CCC(=O)O)C(=NC(CCCCN)C(=NC(CC(=N)O)C(=O)N1CCCC1C(=NC(CC(C)C)C(=O)N1CCCC1C(=NC(CO)C(=NC(CCCCN)C(=NC(CCC(=O)O)C(=NC(C(C)O)C(=NC(C(C)CC)C(=NC(CCC(=O)O)C(=NC(CCC(=N)O)C(=NC(CCC(=O)O)C(=NC(CCCCN)C(=NC(CCC(=N)O)C(=NC(C)C(=NCC(=NC(CCC(=O)O)C(=NC(CO)C(=O)O)O)O)O)O)O)O)O)O)O)O)O)O)O)O)O)O)O)O)O)O)O)O)O)O)O)O)O)O)O)O)O)O)N=C(C(CCC(=O)O)N=C(C(C)N=C(C(CCSC)N=C(C(CC(=O)O)N=C(C1CCCN1C(=O)C(CCCCN)N=C(C(CC(=O)O)N=C(C(CO)N=C(C)O)O)O)O)O)O)O)O
Synonyms:- Thymosin beta(4)
- Fx Peptide
- Thymosin beta4
- Thymosin β4 Acetate
- Thymosin β4
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
Thymosin β₄ (human, bovine, horse, rat)
CAS:Thymosin β₄ is a 43 amino acid peptide which is regarded as the main intracellular G-actin sequestering peptide. Extracellular thymosin β₄ may contribute to physiological processes such as angiogenesis, wound healing, and regulation of inflammation. Additionally to its numerous functions thymosin β₄ might also be of therapeutic value in the setting of acute myocardial damage.Formula:C212H350N56O78SPurity:93.9%Color and Shape:Whitish LyophilisateMolecular weight:4963.51Thymosin β4 (human, bovine, horse, rat)
CAS:Thymosin β4 (human, bovine, horse, rat) is a naturally occurring therapeutic peptide derived from various mammalian sources, including humans, cattle, horses, and rats. It is a member of the β-thymosin family and is ubiquitously expressed in many tissues. The primary mode of action of Thymosin β4 involves its ability to bind actin, thereby facilitating cell motility, angiogenesis, and wound repair. It plays a crucial role in cell migration and the formation of new blood vessels, which is essential for tissue regeneration.The uses and applications of Thymosin β4 are extensive, particularly in fields such as regenerative medicine and ophthalmology, where it is employed to promote healing and tissue repair. It has been investigated for its potential therapeutic effects in conditions such as myocardial infarction, corneal injuries, and chronic wounds due to its regenerative properties. As an endogenous peptide, Thymosin β4’s ability to enhance cellular repair mechanisms makes it a subject of ongoing research to fully elucidate its potential benefits and applications in clinical therapies.Formula:C212H350N56O78SPurity:Min. 95%Molecular weight:4,963.49 g/mol([13C6]Leu17)-Thymosin b4 (human, bovine, horse, rat)
CAS:Thymosin b4 is a protein that has been found to have chemoattractant properties. It can stimulate the movement of cells by binding to G-protein coupled receptors on their surface. Thymosin b4 also has anti-inflammatory activity and modulates immune responses. Thymosin b4 is an important part of the cell signaling pathways that play a role in various diseases, including cancer, infectious disease, coronary heart disease, eye disorders, and autoimmune diseases. Thymosin b4 also regulates transcriptional regulation and may be involved in the development of chemoattractant proteins.Purity:Min. 95%([13C6]Leu17)-Thymosin b4 (human, bovine, horse, rat) trifluoroacetate salt Ac-Ser-Asp-Lys-Pro-Asp-Met-Ala-Glu-Ile-Glu-Lys-Phe-Asp-Lys-Ser-Lys-[13C6]Leu-Lys-Lys-Thr-Glu-Thr-Gln-Glu-Lys-Asn-Pro-Leu-Pro-Ser-Lys-Glu-Thr-Ile-Glu-Gln-Glu-Lys-Gln-Ala-Gly-Glu-Ser-OH trifluoroacetate salt
CAS:Formula:C212H350N56O78SPurity:98%Color and Shape:SolidMolecular weight:4963.4408Thymosin β 4
CAS:Custom research peptide; min purity 95%. For different specs please use the Peptide Quote Tool
Formula:C212H350N56O78SMolecular weight:4,963.5 g/mol



