CAS 776-47-6
:1-ethyl-5-fluoro-1H-indole-2,3-dione
Description:
1-Ethyl-5-fluoro-1H-indole-2,3-dione, with the CAS number 776-47-6, is a synthetic organic compound that belongs to the indole family, characterized by its bicyclic structure containing a fused benzene and pyrrole ring. This compound features a fluorine atom at the 5-position and an ethyl group at the 1-position of the indole ring, contributing to its unique chemical properties. The presence of the dione functional groups (two carbonyl groups) at the 2 and 3 positions enhances its reactivity, making it a potential candidate for various chemical reactions, including nucleophilic additions and cycloadditions. It is often studied for its biological activity, particularly in medicinal chemistry, where indole derivatives are known for their diverse pharmacological properties. The compound's solubility, stability, and reactivity can vary based on environmental conditions and the presence of other functional groups. Overall, 1-ethyl-5-fluoro-1H-indole-2,3-dione is of interest in both synthetic organic chemistry and pharmaceutical research due to its structural features and potential applications.
Formula:C10H8FNO2
InChI:InChI=1/C10H8FNO2/c1-2-12-8-4-3-6(11)5-7(8)9(13)10(12)14/h3-5H,2H2,1H3
SMILES:CCN1c2ccc(cc2C(=O)C1=O)F
Synonyms:- 1H-indole-2,3-dione, 1-ethyl-5-fluoro-
- 1-Ethyl-5-fluoro-1H-indole-2,3-dione
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
1-ethyl-5-fluoro-1H-indole-2,3-dione
CAS:Formula:C10H8FNO2Color and Shape:SolidMolecular weight:193.17441-Ethyl-5-fluoroindoline-2,3-dione
CAS:Controlled ProductApplications 1-Ethyl-5-fluoroindoline-2,3-dione (cas# 776-47-6) is a useful research chemical.
Formula:C10H8NO2FColor and Shape:NeatMolecular weight:193.17

