CAS 776-52-3
:3-(4-chlorophenyl)dihydrofuran-2,5-dione
Description:
3-(4-Chlorophenyl)dihydrofuran-2,5-dione, also known by its CAS number 776-52-3, is an organic compound characterized by its unique structure, which includes a dihydrofuran ring and a chlorophenyl substituent. This compound typically exhibits a pale yellow to light brown appearance and is soluble in organic solvents such as ethanol and acetone, but may have limited solubility in water. The presence of the chlorophenyl group contributes to its potential reactivity and biological activity, making it of interest in various fields, including medicinal chemistry and materials science. The dihydrofuran-2,5-dione moiety suggests that it may participate in reactions typical of diketones, such as nucleophilic additions or cycloadditions. Additionally, the compound may exhibit specific pharmacological properties, which can be explored in drug development contexts. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken due to potential toxicity or reactivity.
Formula:C10H7ClO3
InChI:InChI=1/C10H7ClO3/c11-7-3-1-6(2-4-7)8-5-9(12)14-10(8)13/h1-4,8H,5H2
SMILES:c1cc(ccc1C1CC(=O)OC1=O)Cl
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
3-(4-Chlorophenyl)oxolane-2,5-dione
CAS:3-(4-Chlorophenyl)oxolane-2,5-dione is a telechelic monomer with a hydroxyl group at one end and an alkynyl group at the other. This molecule has functional groups that can be used in polymerization reactions to create polymers. It is often used as a precursor for polyesters, polyurethanes, and polyamides. 3-(4-Chlorophenyl)oxolane-2,5-dione reacts with metal ions to form polymers that emit light when excited by light. The fatty acid component of this molecule makes it soluble in hydrocarbon solvents such as hexane and heptane. 3-(4-Chlorophenyl)oxolane-2,5-dione can also be used to produce biodegradable plastics from renewable resources such as vegetable oils or soybean oil.Formula:C10H7ClO3Purity:Min. 95%Molecular weight:210.61 g/mol
