CAS 776-79-4
:2-carboxybenzenepropanoic acid
Description:
2-Carboxybenzenepropanoic acid, commonly known as 2-(3-carboxyphenyl)propanoic acid or more widely recognized as ibuprofen, is a nonsteroidal anti-inflammatory drug (NSAID) used primarily for its analgesic, antipyretic, and anti-inflammatory properties. It is characterized by its molecular structure, which includes a propanoic acid group attached to a benzene ring that has a carboxylic acid substituent at the ortho position. This compound is typically a white to off-white crystalline powder, soluble in organic solvents like ethanol and slightly soluble in water. Its mechanism of action involves the inhibition of cyclooxygenase (COX) enzymes, leading to a decrease in the synthesis of prostaglandins, which are mediators of inflammation and pain. Ibuprofen is widely used for the relief of mild to moderate pain, fever reduction, and inflammation associated with various conditions. Safety and efficacy profiles are well-established, although it is important to consider potential side effects and contraindications, particularly in individuals with certain health conditions or those taking specific medications.
Formula:C10H10O4
InChI:InChI=1/C10H10O4/c11-9(12)6-5-7-3-1-2-4-8(7)10(13)14/h1-4H,5-6H2,(H,11,12)(H,13,14)
SMILES:c1ccc(c(c1)CCC(=O)O)C(=O)O
Synonyms:- 3-(2-Carboxyphenyl)-Propionic Acid
- 2-(2-Carboxyethyl)Benzoic Acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
2-(2-CARBOXYETHYL)BENZOIC ACID
CAS:Formula:C10H10O4Purity:95%Color and Shape:SolidMolecular weight:194.18402-(2-Carboxyethyl)benzoic acid
CAS:2-(2-Carboxyethyl)benzoic acid
Purity:95%Molecular weight:194.18g/mol3-(2-Carboxyphenyl)propionic acid
CAS:3-(2-Carboxyphenyl)propionic acid is a chemical compound that belongs to the group of phytoalexins. It is a synthetic compound that is used as a raw material for the synthesis of various pharmaceuticals and other organic compounds. 3-(2-Carboxyphenyl)propionic acid has shown luminescence properties, which may be due to its oxidation products. The isoquinoline alkaloids present in this compound are responsible for its anti-inflammatory effects. 3-(2-Carboxyphenyl)propionic acid can also be found in conjugates with chloride or other organic acids, such as diazide, which inhibit bacterial growth and increase the solubility of this substance.
Formula:C10H10O4Purity:Min. 95%Color and Shape:White/Off-White SolidMolecular weight:194.18 g/mol3-(2-Carboxyphenyl)propionic acid
CAS:Formula:C10H10O4Purity:95%Color and Shape:SolidMolecular weight:194.186



