CAS 776-86-3
:Isoscopoletin
Description:
Isoscopoletin, with the CAS number 776-86-3, is a naturally occurring compound classified as a coumarin derivative. It is characterized by its aromatic structure, which includes a benzopyran ring fused to a carbonyl group. Isoscopoletin is known for its potential biological activities, including antioxidant, anti-inflammatory, and antimicrobial properties. It is commonly found in various plants, particularly in the Apiaceae family, and is often studied for its pharmacological effects. The compound exhibits solubility in organic solvents and has a relatively low solubility in water, which is typical for many coumarins. Isoscopoletin's molecular formula reflects its complex structure, and it can be identified through various spectroscopic methods, including UV-Vis and NMR spectroscopy. Due to its bioactive properties, isoscopoletin is of interest in the fields of medicinal chemistry and natural product research, where it may contribute to the development of therapeutic agents.
Formula:C10H8O4
InChI:InChI=1S/C10H8O4/c1-13-9-5-8-6(4-7(9)11)2-3-10(12)14-8/h2-5,11H,1H3
InChI key:InChIKey=SYTYLPHCLSSCOJ-UHFFFAOYSA-N
SMILES:O(C)C=1C=C2C(=CC1O)C=CC(=O)O2
Synonyms:- 2H-1-Benzopyran-2-one, 6-hydroxy-7-methoxy-
- 6-Hydroxy-7-methoxy-2H-1-benzopyran-2-one
- 6-Hydroxy-7-methoxycoumarin
- 6-hydroxy-7-methoxy-2H-chromen-2-one
- 7-Methoxyesculetin
- Coumarin, 6-hydroxy-7-methoxy-
- Esculetin, 7-methyl ether
- Herniarin, 6-hydroxy-
- Isoscopoletin
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 11 products.
Isoscopoletin
CAS:Isoscopoletin analytical standard provided with chromatographic purity, to be used as reference material for qualitative determination.Formula:C10H8O4Purity:(HPLC) ≥95%Color and Shape:PowderMolecular weight:192.172H-1-Benzopyran-2-one, 6-hydroxy-7-methoxy-
CAS:Formula:C10H8O4Purity:98%Color and Shape:SolidMolecular weight:192.1681Isoscopoletin
CAS:Isoscopoletin (7-Methoxyesculetin) is a predicted metabolite generated by BioTransformer1 that is produced by the metabolism of 6, 7-dimethoxy-2h-chromen-2-one.Formula:C10H8O4Purity:98.01% - 99.96%Color and Shape:SolidMolecular weight:192.17Isoscopoletin
CAS:LactoneFormula:C10H8O4Purity:≥ 90.0 % (HPLC)Color and Shape:PowderMolecular weight:192.17Isoscopoletin
CAS:Isoscopoletin is a naturally occurring coumarin derivative, which is typically sourced from various plants, including some medicinal herbs. This compound is found in a variety of plant species, where it plays a role in the plant's defense mechanisms against pathogens. It is known for its characteristic chemical structure that belongs to the coumarin family, which is widespread in the plant kingdom.Formula:C10H8O4Purity:Min. 95%Color and Shape:PowderMolecular weight:192.17 g/mol6-Hydroxy-7-methoxycoumarin
CAS:Controlled ProductApplications 6-Hydroxy-7-methoxycoumarin (cas# 776-86-3) is a useful research chemical.
Formula:C10H8O4Color and Shape:NeatMolecular weight:192.17









