
CAS 776-88-5
:5,5-Dimethyl-2-phenyl-1,3-dioxane
Description:
5,5-Dimethyl-2-phenyl-1,3-dioxane, with the CAS number 776-88-5, is an organic compound characterized by its dioxane structure, which features a six-membered ring containing two oxygen atoms. This compound typically exhibits a colorless to pale yellow appearance and is known for its aromatic properties due to the presence of a phenyl group. It is soluble in organic solvents and has limited solubility in water. The presence of the dimethyl groups contributes to its steric hindrance, influencing its reactivity and interactions with other molecules. 5,5-Dimethyl-2-phenyl-1,3-dioxane is often utilized in organic synthesis and may serve as an intermediate in the production of various chemical compounds. Its stability and reactivity can vary depending on the conditions, such as temperature and the presence of catalysts. As with many organic compounds, proper handling and safety precautions are essential due to potential health hazards associated with exposure.
Formula:C12H16O2
InChI:InChI=1S/C12H16O2/c1-12(2)8-13-11(14-9-12)10-6-4-3-5-7-10/h3-7,11H,8-9H2,1-2H3
InChI key:InChIKey=VUJMMVJKRWURKX-UHFFFAOYSA-N
SMILES:CC1(C)COC(OC1)C2=CC=CC=C2
Synonyms:- 1,3-Dioxane, 5,5-dimethyl-2-phenyl-
- 2-Phenyl-5,5-dimethyl-m-dioxane
- 2-Phenyl-5,5-dimethyl-1,3-dioxane
- 5,5-Dimethyl-2-phenyl-1,3-dioxane
- m-Dioxane, 5,5-dimethyl-2-phenyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
1,3-Dioxane, 5,5-dimethyl-2-phenyl-
CAS:1,3-Dioxane, 5,5-dimethyl-2-phenyl- is a bioactive chemical.Formula:C12H16O2Color and Shape:SolidMolecular weight:192.25
