CAS 77614-17-6
:L-tyrosyl-D-alanyl-L-phenylalanylglycyl-L-tyrosyl-(4R)-4-hydroxy-L-prolyl-L-serinamide
Description:
L-tyrosyl-D-alanyl-L-phenylalanylglycyl-L-tyrosyl-(4R)-4-hydroxy-L-prolyl-L-serinamide, with the CAS number 77614-17-6, is a synthetic peptide that consists of a sequence of amino acids, including tyrosine, alanine, phenylalanine, glycine, proline, and serine. This compound is characterized by its specific arrangement of these amino acids, which contributes to its unique biochemical properties and potential biological activities. Peptides like this one can exhibit various functions, including acting as signaling molecules, influencing metabolic pathways, or serving as precursors for larger proteins. The presence of specific amino acids, such as the hydroxyproline, may enhance stability and influence interactions with biological targets. Additionally, the chirality of the amino acids in the sequence can affect the peptide's conformation and activity. Overall, this compound may be of interest in pharmaceutical research, particularly in the development of therapeutic agents or as a tool for studying protein interactions and functions.
Formula:C40H50N8O11
InChI:InChI=1/C40H50N8O11/c1-22(44-37(56)29(41)15-24-7-11-26(50)12-8-24)36(55)46-30(16-23-5-3-2-4-6-23)38(57)43-19-34(53)45-31(17-25-9-13-27(51)14-10-25)40(59)48-20-28(52)18-33(48)39(58)47-32(21-49)35(42)54/h2-14,22,28-33,49-52H,15-21,41H2,1H3,(H2,42,54)(H,43,57)(H,44,56)(H,45,53)(H,46,55)(H,47,58)/t22-,28-,29+,30+,31+,32+,33+/m1/s1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.