CAS 77618-99-6

2-Amino-5-methylthiopyridine

Description:

2-Amino-5-methylthiopyridine is an organic compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing one nitrogen atom. The presence of an amino group (-NH2) at the 2-position and a methylthio group (-S-CH3) at the 5-position contributes to its unique chemical properties. This compound typically appears as a solid or liquid, depending on its purity and form. It is soluble in polar solvents such as water and alcohols, which is influenced by the amino group that can engage in hydrogen bonding. 2-Amino-5-methylthiopyridine can participate in various chemical reactions, including nucleophilic substitutions and condensation reactions, making it useful in organic synthesis and medicinal chemistry. Its derivatives may exhibit biological activity, which is of interest in pharmaceutical research. Safety data indicates that, like many amines, it should be handled with care due to potential irritant properties. Overall, this compound serves as a valuable building block in the synthesis of more complex molecules.

Formula: C₆H₈N₂S

InChI: InChI=1/C6H8N2S/c1-9-5-2-3-6(7)8-4-5/h2-4H,1H3,(H2,7,8)

SMILES: CSc1ccc(=N)[nH]c1

Synonyms:

• 5-(Methylsulfanyl)Pyridin-2-Amine

5-(Methylsulfanyl)pyridin-2-amine

CAS: 77618-99-6

Formula: C₆H₈N₂S

Purity: 98%

Color and Shape: Solid

Molecular weight: 140.2061

Ref: IN-DA008OT4

2-Amino-5-(Methylthio)Pyridine

CAS: 77618-99-6

2-Amino-5-(Methylthio)Pyridine

Purity: 99%

Molecular weight: 140.21g/mol

Ref: 54-OR1025597

2-Amino-5-(methylthio)pyridine

CAS: 77618-99-6

Formula: C₆H₈N₂S

Purity: 98%

Molecular weight: 140.2

Ref: 10-F223247

2-Amino-5-(methylthio)pyridine

CAS: 77618-99-6

2-Amino-5-(methylthio)pyridine is a chemical intermediate that is used in pharmaceutical products. It has been shown to be sensitive to impurities and reactive, which may cause it to undergo mutagenic reactions. 2-Amino-5-(methylthio)pyridine is a product of the reaction between methylamine and nitrosamines. This compound can be used as an intermediate in the synthesis of pharmaceuticals such as aminopyridines, aminothiazoles, and 3-aminoquinazolines. 2-Amino-5-(methylthio)pyridine is also used in the production of intermediates for other chemicals such as amino acid esters, dyes, and pesticides.

Formula: C₆H₈N₂S

Purity: Min. 95%

Molecular weight: 140.21 g/mol

Ref: 3D-CDA61899